About 2-[methyl(2-methylpropyl)amino]ethyl N-propylcarbamate
2-[methyl(2-methylpropyl)amino]ethyl N-propylcarbamate (PubChem CID 156523887) has the molecular formula C11H24N2O2
and a molecular weight of 216.32 g/mol. Its IUPAC name is 2-[methyl(2-methylpropyl)amino]ethyl N-propylcarbamate.
Molecular Properties
| Compound Name | 2-[methyl(2-methylpropyl)amino]ethyl N-propylcarbamate |
| PubChem CID | 156523887 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | 2-[methyl(2-methylpropyl)amino]ethyl N-propylcarbamate |
| SMILES | CCCNC(=O)OCCN(C)CC(C)C |
| InChI | InChI=1S/C11H24N2O2/c1-5-6-12-11(14)15-8-7-13(4)9-10(2)3/h10H,5-9H2,1-4H3,(H,12,14) |
| InChIKey | VLPWRVHBVPBBCC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[methyl(2-methylpropyl)amino]ethyl N-propylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[methyl(2-methylpropyl)amino]ethyl N-propylcarbamate?
The IUPAC name of 2-[methyl(2-methylpropyl)amino]ethyl N-propylcarbamate (CID 156523887) is 2-[methyl(2-methylpropyl)amino]ethyl N-propylcarbamate.
What is the SMILES notation for 2-[methyl(2-methylpropyl)amino]ethyl N-propylcarbamate?
The canonical SMILES for 2-[methyl(2-methylpropyl)amino]ethyl N-propylcarbamate is CCCNC(=O)OCCN(C)CC(C)C.
What is the InChIKey of 2-[methyl(2-methylpropyl)amino]ethyl N-propylcarbamate?
The InChIKey is VLPWRVHBVPBBCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2O2/c1-5-6-12-11(14)15-8-7-13(4)9-10(2)3/h10H,5-9H2,1-4H3,(H,12,14).
What are the key properties of 2-[methyl(2-methylpropyl)amino]ethyl N-propylcarbamate?
2-[methyl(2-methylpropyl)amino]ethyl N-propylcarbamate has a molecular weight of 216.32 g/mol, XLogP of 1.71, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[methyl(2-methylpropyl)amino]ethyl N-propylcarbamate is sourced from PubChem (CID 156523887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).