C19H21N3O3S2 — CID 23603157
2-[(2-methyl-1,3-benzothiazol-6-yl)sulfonylamino]-N-(3-phenylpropyl)acetamide (PubChem CID 23603157) has the molecular formula C19H21N3O3S2 and a molecular weight of 403.53 g/mol. Its IUPAC name is 2-[(2-methyl-1,3-benzothiazol-6-yl)sulfonylamino]-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-[(2-methyl-1,3-benzothiazol-6-yl)sulfonylamino]-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 23603157 |
| Molecular Formula | C19H21N3O3S2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 2-[(2-methyl-1,3-benzothiazol-6-yl)sulfonylamino]-N-(3-phenylpropyl)acetamide |
| SMILES | Cc1nc2ccc(S(=O)(=O)NCC(=O)NCCCc3ccccc3)cc2s1 |
| InChI | InChI=1S/C19H21N3O3S2/c1-14-22-17-10-9-16(12-18(17)26-14)27(24,25)21-13-19(23)20-11-5-8-15-6-3-2-4-7-15/h2-4,6-7,9-10,12,21H,5,8,11,13H2,1H3,(H,20,23) |
| InChIKey | RXVYGBWRXKBNOG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|