C16H18N2O3S2 — CID 56913871
(3aR,4R,7S,7aS)-2-[(2-methyl-1,3-benzothiazol-6-yl)sulfonyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole (PubChem CID 56913871) has the molecular formula C16H18N2O3S2 and a molecular weight of 350.47 g/mol. Its IUPAC name is (3aR,4R,7S,7aS)-2-[(2-methyl-1,3-benzothiazol-6-yl)sulfonyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole.
| Compound Name | (3aR,4R,7S,7aS)-2-[(2-methyl-1,3-benzothiazol-6-yl)sulfonyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole |
|---|---|
| PubChem CID | 56913871 |
| Molecular Formula | C16H18N2O3S2 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | (3aR,4R,7S,7aS)-2-[(2-methyl-1,3-benzothiazol-6-yl)sulfonyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole |
| SMILES | Cc1nc2ccc(S(=O)(=O)N3C[C@@H]4[C@H](C3)[C@H]3CC[C@@H]4O3)cc2s1 |
| InChI | InChI=1S/C16H18N2O3S2/c1-9-17-13-3-2-10(6-16(13)22-9)23(19,20)18-7-11-12(8-18)15-5-4-14(11)21-15/h2-3,6,11-12,14-15H,4-5,7-8H2,1H3/t11-,12+,14+,15- |
| InChIKey | BEIWKWKYLZVURF-IKARSPCKSA-N |
| XLogP | 2.40 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |