C12H15N3O2S2 — CID 46180600
2-methyl-5-piperazin-1-ylsulfonyl-1,3-benzothiazole (PubChem CID 46180600) has the molecular formula C12H15N3O2S2 and a molecular weight of 297.41 g/mol. Its IUPAC name is 2-methyl-5-piperazin-1-ylsulfonyl-1,3-benzothiazole.
| Compound Name | 2-methyl-5-piperazin-1-ylsulfonyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 46180600 |
| Molecular Formula | C12H15N3O2S2 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 2-methyl-5-piperazin-1-ylsulfonyl-1,3-benzothiazole |
| SMILES | Cc1nc2cc(S(=O)(=O)N3CCNCC3)ccc2s1 |
| InChI | InChI=1S/C12H15N3O2S2/c1-9-14-11-8-10(2-3-12(11)18-9)19(16,17)15-6-4-13-5-7-15/h2-3,8,13H,4-7H2,1H3 |
| InChIKey | DBFLCEGOGDFDAO-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |