C11H13N3O3S2 — CID 146346248
(3S)-1-[(2-amino-1,3-benzothiazol-6-yl)sulfonyl]pyrrolidin-3-ol (PubChem CID 146346248) has the molecular formula C11H13N3O3S2 and a molecular weight of 299.38 g/mol. Its IUPAC name is (3S)-1-[(2-amino-1,3-benzothiazol-6-yl)sulfonyl]pyrrolidin-3-ol.
| Compound Name | (3S)-1-[(2-amino-1,3-benzothiazol-6-yl)sulfonyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 146346248 |
| Molecular Formula | C11H13N3O3S2 |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | (3S)-1-[(2-amino-1,3-benzothiazol-6-yl)sulfonyl]pyrrolidin-3-ol |
| SMILES | Nc1nc2ccc(S(=O)(=O)N3CC[C@H](O)C3)cc2s1 |
| InChI | InChI=1S/C11H13N3O3S2/c12-11-13-9-2-1-8(5-10(9)18-11)19(16,17)14-4-3-7(15)6-14/h1-2,5,7,15H,3-4,6H2,(H2,12,13)/t7-/m0/s1 |
| InChIKey | AXGOINPWQGOQMK-ZETCQYMHSA-N |
| XLogP | 0.63 |
| TPSA | 96.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |