C12H21N5O3S — CID 106242080
4-amino-N-[2-(2-amino-2-oxoethoxy)ethyl]-2-(tert-butylamino)-1,3-thiazole-5-carboxamide (PubChem CID 106242080) has the molecular formula C12H21N5O3S and a molecular weight of 315.40 g/mol. Its IUPAC name is 4-amino-N-[2-(2-amino-2-oxoethoxy)ethyl]-2-(tert-butylamino)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-N-[2-(2-amino-2-oxoethoxy)ethyl]-2-(tert-butylamino)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 106242080 |
| Molecular Formula | C12H21N5O3S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 4-amino-N-[2-(2-amino-2-oxoethoxy)ethyl]-2-(tert-butylamino)-1,3-thiazole-5-carboxamide |
| SMILES | CC(C)(C)Nc1nc(N)c(C(=O)NCCOCC(N)=O)s1 |
| InChI | InChI=1S/C12H21N5O3S/c1-12(2,3)17-11-16-9(14)8(21-11)10(19)15-4-5-20-6-7(13)18/h4-6,14H2,1-3H3,(H2,13,18)(H,15,19)(H,16,17) |
| InChIKey | DUWRTXDUGJIXLE-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 132.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|