C10H17N5O3S — CID 116672206
2-[[4-amino-2-(propan-2-ylamino)-1,3-thiazole-5-carbonyl]amino]ethyl carbamate (PubChem CID 116672206) has the molecular formula C10H17N5O3S and a molecular weight of 287.35 g/mol. Its IUPAC name is 2-[[4-amino-2-(propan-2-ylamino)-1,3-thiazole-5-carbonyl]amino]ethyl carbamate.
| Compound Name | 2-[[4-amino-2-(propan-2-ylamino)-1,3-thiazole-5-carbonyl]amino]ethyl carbamate |
|---|---|
| PubChem CID | 116672206 |
| Molecular Formula | C10H17N5O3S |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 2-[[4-amino-2-(propan-2-ylamino)-1,3-thiazole-5-carbonyl]amino]ethyl carbamate |
| SMILES | CC(C)Nc1nc(N)c(C(=O)NCCOC(N)=O)s1 |
| InChI | InChI=1S/C10H17N5O3S/c1-5(2)14-10-15-7(11)6(19-10)8(16)13-3-4-18-9(12)17/h5H,3-4,11H2,1-2H3,(H2,12,17)(H,13,16)(H,14,15) |
| InChIKey | IXLWGAGOGITSKQ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 132.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|