C10H18N6O2S — CID 116672310
4-amino-N-[2-(carbamoylamino)ethyl]-2-(propan-2-ylamino)-1,3-thiazole-5-carboxamide (PubChem CID 116672310) has the molecular formula C10H18N6O2S and a molecular weight of 286.36 g/mol. Its IUPAC name is 4-amino-N-[2-(carbamoylamino)ethyl]-2-(propan-2-ylamino)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-N-[2-(carbamoylamino)ethyl]-2-(propan-2-ylamino)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 116672310 |
| Molecular Formula | C10H18N6O2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 4-amino-N-[2-(carbamoylamino)ethyl]-2-(propan-2-ylamino)-1,3-thiazole-5-carboxamide |
| SMILES | CC(C)Nc1nc(N)c(C(=O)NCCNC(N)=O)s1 |
| InChI | InChI=1S/C10H18N6O2S/c1-5(2)15-10-16-7(11)6(19-10)8(17)13-3-4-14-9(12)18/h5H,3-4,11H2,1-2H3,(H,13,17)(H,15,16)(H3,12,14,18) |
| InChIKey | LLRQSIABMQQIAQ-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 135.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|