C9H15N5O3S — CID 116672210
2-[[4-amino-2-(dimethylamino)-1,3-thiazole-5-carbonyl]amino]ethyl carbamate (PubChem CID 116672210) has the molecular formula C9H15N5O3S and a molecular weight of 273.32 g/mol. Its IUPAC name is 2-[[4-amino-2-(dimethylamino)-1,3-thiazole-5-carbonyl]amino]ethyl carbamate.
| Compound Name | 2-[[4-amino-2-(dimethylamino)-1,3-thiazole-5-carbonyl]amino]ethyl carbamate |
|---|---|
| PubChem CID | 116672210 |
| Molecular Formula | C9H15N5O3S |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 2-[[4-amino-2-(dimethylamino)-1,3-thiazole-5-carbonyl]amino]ethyl carbamate |
| SMILES | CN(C)c1nc(N)c(C(=O)NCCOC(N)=O)s1 |
| InChI | InChI=1S/C9H15N5O3S/c1-14(2)9-13-6(10)5(18-9)7(15)12-3-4-17-8(11)16/h3-4,10H2,1-2H3,(H2,11,16)(H,12,15) |
| InChIKey | AGTFTQJEVSYOPI-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 123.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|