C9H16N6O2S — CID 116672314
4-amino-N-[2-(carbamoylamino)ethyl]-2-(dimethylamino)-1,3-thiazole-5-carboxamide (PubChem CID 116672314) has the molecular formula C9H16N6O2S and a molecular weight of 272.33 g/mol. Its IUPAC name is 4-amino-N-[2-(carbamoylamino)ethyl]-2-(dimethylamino)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-N-[2-(carbamoylamino)ethyl]-2-(dimethylamino)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 116672314 |
| Molecular Formula | C9H16N6O2S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 4-amino-N-[2-(carbamoylamino)ethyl]-2-(dimethylamino)-1,3-thiazole-5-carboxamide |
| SMILES | CN(C)c1nc(N)c(C(=O)NCCNC(N)=O)s1 |
| InChI | InChI=1S/C9H16N6O2S/c1-15(2)9-14-6(10)5(18-9)7(16)12-3-4-13-8(11)17/h3-4,10H2,1-2H3,(H,12,16)(H3,11,13,17) |
| InChIKey | QJJARLTZUGSGCY-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 126.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|