C10H17N5O3S — CID 116670183
4-amino-N-(3-amino-3-oxopropyl)-2-(2-methoxyethylamino)-1,3-thiazole-5-carboxamide (PubChem CID 116670183) has the molecular formula C10H17N5O3S and a molecular weight of 287.34 g/mol. Its IUPAC name is 4-amino-N-(3-amino-3-oxopropyl)-2-(2-methoxyethylamino)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-N-(3-amino-3-oxopropyl)-2-(2-methoxyethylamino)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 116670183 |
| Molecular Formula | C10H17N5O3S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 4-amino-N-(3-amino-3-oxopropyl)-2-(2-methoxyethylamino)-1,3-thiazole-5-carboxamide |
| SMILES | COCCNc1nc(N)c(C(=O)NCCC(N)=O)s1 |
| InChI | InChI=1S/C10H17N5O3S/c1-18-5-4-14-10-15-8(12)7(19-10)9(17)13-3-2-6(11)16/h2-5,12H2,1H3,(H2,11,16)(H,13,17)(H,14,15) |
| InChIKey | QAYYRHIPUWDYBG-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 132.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|