C10H17N5O2S — CID 106242070
4-amino-N-(5-amino-5-oxopentyl)-2-(methylamino)-1,3-thiazole-5-carboxamide (PubChem CID 106242070) has the molecular formula C10H17N5O2S and a molecular weight of 271.35 g/mol. Its IUPAC name is 4-amino-N-(5-amino-5-oxopentyl)-2-(methylamino)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-N-(5-amino-5-oxopentyl)-2-(methylamino)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 106242070 |
| Molecular Formula | C10H17N5O2S |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 4-amino-N-(5-amino-5-oxopentyl)-2-(methylamino)-1,3-thiazole-5-carboxamide |
| SMILES | CNc1nc(N)c(C(=O)NCCCCC(N)=O)s1 |
| InChI | InChI=1S/C10H17N5O2S/c1-13-10-15-8(12)7(18-10)9(17)14-5-3-2-4-6(11)16/h2-5,12H2,1H3,(H2,11,16)(H,13,15)(H,14,17) |
| InChIKey | DZCIFLDGDNRXNF-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|