C12H22N6OS — CID 116663035
4-amino-2-(methylamino)-N-(3-piperazin-1-ylpropyl)-1,3-thiazole-5-carboxamide (PubChem CID 116663035) has the molecular formula C12H22N6OS and a molecular weight of 298.42 g/mol. Its IUPAC name is 4-amino-2-(methylamino)-N-(3-piperazin-1-ylpropyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-2-(methylamino)-N-(3-piperazin-1-ylpropyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 116663035 |
| Molecular Formula | C12H22N6OS |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 4-amino-2-(methylamino)-N-(3-piperazin-1-ylpropyl)-1,3-thiazole-5-carboxamide |
| SMILES | CNc1nc(N)c(C(=O)NCCCN2CCNCC2)s1 |
| InChI | InChI=1S/C12H22N6OS/c1-14-12-17-10(13)9(20-12)11(19)16-3-2-6-18-7-4-15-5-8-18/h15H,2-8,13H2,1H3,(H,14,17)(H,16,19) |
| InChIKey | HHGLLPONXVVNFV-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 95.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|