C13H21N5O2S — CID 106242065
4-amino-N-(5-amino-5-oxopentyl)-2-pyrrolidin-1-yl-1,3-thiazole-5-carboxamide (PubChem CID 106242065) has the molecular formula C13H21N5O2S and a molecular weight of 311.41 g/mol. Its IUPAC name is 4-amino-N-(5-amino-5-oxopentyl)-2-pyrrolidin-1-yl-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-N-(5-amino-5-oxopentyl)-2-pyrrolidin-1-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 106242065 |
| Molecular Formula | C13H21N5O2S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 4-amino-N-(5-amino-5-oxopentyl)-2-pyrrolidin-1-yl-1,3-thiazole-5-carboxamide |
| SMILES | NC(=O)CCCCNC(=O)c1sc(N2CCCC2)nc1N |
| InChI | InChI=1S/C13H21N5O2S/c14-9(19)5-1-2-6-16-12(20)10-11(15)17-13(21-10)18-7-3-4-8-18/h1-8,15H2,(H2,14,19)(H,16,20) |
| InChIKey | JELQEYKTCJCNAR-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 114.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|