C11H17N5O3S — CID 116672202
2-[(4-amino-2-pyrrolidin-1-yl-1,3-thiazole-5-carbonyl)amino]ethyl carbamate (PubChem CID 116672202) has the molecular formula C11H17N5O3S and a molecular weight of 299.36 g/mol. Its IUPAC name is 2-[(4-amino-2-pyrrolidin-1-yl-1,3-thiazole-5-carbonyl)amino]ethyl carbamate.
| Compound Name | 2-[(4-amino-2-pyrrolidin-1-yl-1,3-thiazole-5-carbonyl)amino]ethyl carbamate |
|---|---|
| PubChem CID | 116672202 |
| Molecular Formula | C11H17N5O3S |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 2-[(4-amino-2-pyrrolidin-1-yl-1,3-thiazole-5-carbonyl)amino]ethyl carbamate |
| SMILES | NC(=O)OCCNC(=O)c1sc(N2CCCC2)nc1N |
| InChI | InChI=1S/C11H17N5O3S/c12-8-7(9(17)14-3-6-19-10(13)18)20-11(15-8)16-4-1-2-5-16/h1-6,12H2,(H2,13,18)(H,14,17) |
| InChIKey | VZHHFIKVKZALPI-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 123.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|