C13H24N6OS — CID 116662970
4-amino-2-(4-aminopiperidin-1-yl)-N-[3-(methylamino)propyl]-1,3-thiazole-5-carboxamide (PubChem CID 116662970) has the molecular formula C13H24N6OS and a molecular weight of 312.44 g/mol. Its IUPAC name is 4-amino-2-(4-aminopiperidin-1-yl)-N-[3-(methylamino)propyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-2-(4-aminopiperidin-1-yl)-N-[3-(methylamino)propyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 116662970 |
| Molecular Formula | C13H24N6OS |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 4-amino-2-(4-aminopiperidin-1-yl)-N-[3-(methylamino)propyl]-1,3-thiazole-5-carboxamide |
| SMILES | CNCCCNC(=O)c1sc(N2CCC(N)CC2)nc1N |
| InChI | InChI=1S/C13H24N6OS/c1-16-5-2-6-17-12(20)10-11(15)18-13(21-10)19-7-3-9(14)4-8-19/h9,16H,2-8,14-15H2,1H3,(H,17,20) |
| InChIKey | GSLFDYKCYHIBSR-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 109.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|