C11H19N5O3S — CID 116669742
4-amino-N-[2-(dimethylamino)-2-oxoethyl]-2-(2-methoxyethylamino)-1,3-thiazole-5-carboxamide (PubChem CID 116669742) has the molecular formula C11H19N5O3S and a molecular weight of 301.37 g/mol. Its IUPAC name is 4-amino-N-[2-(dimethylamino)-2-oxoethyl]-2-(2-methoxyethylamino)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-N-[2-(dimethylamino)-2-oxoethyl]-2-(2-methoxyethylamino)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 116669742 |
| Molecular Formula | C11H19N5O3S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 4-amino-N-[2-(dimethylamino)-2-oxoethyl]-2-(2-methoxyethylamino)-1,3-thiazole-5-carboxamide |
| SMILES | COCCNc1nc(N)c(C(=O)NCC(=O)N(C)C)s1 |
| InChI | InChI=1S/C11H19N5O3S/c1-16(2)7(17)6-14-10(18)8-9(12)15-11(20-8)13-4-5-19-3/h4-6,12H2,1-3H3,(H,13,15)(H,14,18) |
| InChIKey | YQJHNYJSCAAHGB-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|