C12H22N4O3S — CID 116673698
4-amino-N-(4-hydroxy-2-methylbutan-2-yl)-2-(2-methoxyethylamino)-1,3-thiazole-5-carboxamide (PubChem CID 116673698) has the molecular formula C12H22N4O3S and a molecular weight of 302.40 g/mol. Its IUPAC name is 4-amino-N-(4-hydroxy-2-methylbutan-2-yl)-2-(2-methoxyethylamino)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-N-(4-hydroxy-2-methylbutan-2-yl)-2-(2-methoxyethylamino)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 116673698 |
| Molecular Formula | C12H22N4O3S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 4-amino-N-(4-hydroxy-2-methylbutan-2-yl)-2-(2-methoxyethylamino)-1,3-thiazole-5-carboxamide |
| SMILES | COCCNc1nc(N)c(C(=O)NC(C)(C)CCO)s1 |
| InChI | InChI=1S/C12H22N4O3S/c1-12(2,4-6-17)16-10(18)8-9(13)15-11(20-8)14-5-7-19-3/h17H,4-7,13H2,1-3H3,(H,14,15)(H,16,18) |
| InChIKey | FYBIKOQZJXKLCT-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|