C14H26N4O2S — CID 116666462
4-amino-2-(2-methoxyethylamino)-N-(5-methylhexan-2-yl)-1,3-thiazole-5-carboxamide (PubChem CID 116666462) has the molecular formula C14H26N4O2S and a molecular weight of 314.46 g/mol. Its IUPAC name is 4-amino-2-(2-methoxyethylamino)-N-(5-methylhexan-2-yl)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-2-(2-methoxyethylamino)-N-(5-methylhexan-2-yl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 116666462 |
| Molecular Formula | C14H26N4O2S |
| Molecular Weight | 314.46 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | 4-amino-2-(2-methoxyethylamino)-N-(5-methylhexan-2-yl)-1,3-thiazole-5-carboxamide |
| SMILES | COCCNc1nc(N)c(C(=O)NC(C)CCC(C)C)s1 |
| InChI | InChI=1S/C14H26N4O2S/c1-9(2)5-6-10(3)17-13(19)11-12(15)18-14(21-11)16-7-8-20-4/h9-10H,5-8,15H2,1-4H3,(H,16,18)(H,17,19) |
| InChIKey | DCUQNGZGIMRKKA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.46 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|