C11H20N4OS2 — CID 116666516
4-amino-2-(tert-butylamino)-N-(2-methylsulfanylethyl)-1,3-thiazole-5-carboxamide (PubChem CID 116666516) has the molecular formula C11H20N4OS2 and a molecular weight of 288.44 g/mol. Its IUPAC name is 4-amino-2-(tert-butylamino)-N-(2-methylsulfanylethyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-2-(tert-butylamino)-N-(2-methylsulfanylethyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 116666516 |
| Molecular Formula | C11H20N4OS2 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 4-amino-2-(tert-butylamino)-N-(2-methylsulfanylethyl)-1,3-thiazole-5-carboxamide |
| SMILES | CSCCNC(=O)c1sc(NC(C)(C)C)nc1N |
| InChI | InChI=1S/C11H20N4OS2/c1-11(2,3)15-10-14-8(12)7(18-10)9(16)13-5-6-17-4/h5-6,12H2,1-4H3,(H,13,16)(H,14,15) |
| InChIKey | HKNCGNBPNCBELU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|