C11H11IN4OS — CID 116669239
4-amino-N-(4-iodophenyl)-2-(methylamino)-1,3-thiazole-5-carboxamide (PubChem CID 116669239) has the molecular formula C11H11IN4OS and a molecular weight of 374.21 g/mol. Its IUPAC name is 4-amino-N-(4-iodophenyl)-2-(methylamino)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-N-(4-iodophenyl)-2-(methylamino)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 116669239 |
| Molecular Formula | C11H11IN4OS |
| Molecular Weight | 374.21 g/mol |
| Exact Mass | 373.97 |
| IUPAC Name | 4-amino-N-(4-iodophenyl)-2-(methylamino)-1,3-thiazole-5-carboxamide |
| SMILES | CNc1nc(N)c(C(=O)Nc2ccc(I)cc2)s1 |
| InChI | InChI=1S/C11H11IN4OS/c1-14-11-16-9(13)8(18-11)10(17)15-7-4-2-6(12)3-5-7/h2-5H,13H2,1H3,(H,14,16)(H,15,17) |
| InChIKey | DITOMTPWQDYNQN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.21 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|