C11H9F3N4OS — CID 116665575
4-amino-2-(methylamino)-N-(3,4,5-trifluorophenyl)-1,3-thiazole-5-carboxamide (PubChem CID 116665575) has the molecular formula C11H9F3N4OS and a molecular weight of 302.28 g/mol. Its IUPAC name is 4-amino-2-(methylamino)-N-(3,4,5-trifluorophenyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-2-(methylamino)-N-(3,4,5-trifluorophenyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 116665575 |
| Molecular Formula | C11H9F3N4OS |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 4-amino-2-(methylamino)-N-(3,4,5-trifluorophenyl)-1,3-thiazole-5-carboxamide |
| SMILES | CNc1nc(N)c(C(=O)Nc2cc(F)c(F)c(F)c2)s1 |
| InChI | InChI=1S/C11H9F3N4OS/c1-16-11-18-9(15)8(20-11)10(19)17-4-2-5(12)7(14)6(13)3-4/h2-3H,15H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | MHHKCQUFDCBEKP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|