C12H11F3N4OS — CID 116665570
4-amino-2-(ethylamino)-N-(2,4,5-trifluorophenyl)-1,3-thiazole-5-carboxamide (PubChem CID 116665570) has the molecular formula C12H11F3N4OS and a molecular weight of 316.31 g/mol. Its IUPAC name is 4-amino-2-(ethylamino)-N-(2,4,5-trifluorophenyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-2-(ethylamino)-N-(2,4,5-trifluorophenyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 116665570 |
| Molecular Formula | C12H11F3N4OS |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 4-amino-2-(ethylamino)-N-(2,4,5-trifluorophenyl)-1,3-thiazole-5-carboxamide |
| SMILES | CCNc1nc(N)c(C(=O)Nc2cc(F)c(F)cc2F)s1 |
| InChI | InChI=1S/C12H11F3N4OS/c1-2-17-12-19-10(16)9(21-12)11(20)18-8-4-6(14)5(13)3-7(8)15/h3-4H,2,16H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | WKYYEPRKVSOSGN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|