C11H10FIN4OS — CID 116671143
4-amino-N-(4-fluoro-2-iodophenyl)-2-(methylamino)-1,3-thiazole-5-carboxamide (PubChem CID 116671143) has the molecular formula C11H10FIN4OS and a molecular weight of 392.20 g/mol. Its IUPAC name is 4-amino-N-(4-fluoro-2-iodophenyl)-2-(methylamino)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-N-(4-fluoro-2-iodophenyl)-2-(methylamino)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 116671143 |
| Molecular Formula | C11H10FIN4OS |
| Molecular Weight | 392.20 g/mol |
| Exact Mass | 391.96 |
| IUPAC Name | 4-amino-N-(4-fluoro-2-iodophenyl)-2-(methylamino)-1,3-thiazole-5-carboxamide |
| SMILES | CNc1nc(N)c(C(=O)Nc2ccc(F)cc2I)s1 |
| InChI | InChI=1S/C11H10FIN4OS/c1-15-11-17-9(14)8(19-11)10(18)16-7-3-2-5(12)4-6(7)13/h2-4H,14H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | BBHYOZUTXHESAN-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.20 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|