C13H15IN4OS — CID 116669238
4-amino-2-[ethyl(methyl)amino]-N-(4-iodophenyl)-1,3-thiazole-5-carboxamide (PubChem CID 116669238) has the molecular formula C13H15IN4OS and a molecular weight of 402.26 g/mol. Its IUPAC name is 4-amino-2-[ethyl(methyl)amino]-N-(4-iodophenyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-2-[ethyl(methyl)amino]-N-(4-iodophenyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 116669238 |
| Molecular Formula | C13H15IN4OS |
| Molecular Weight | 402.26 g/mol |
| Exact Mass | 402.00 |
| IUPAC Name | 4-amino-2-[ethyl(methyl)amino]-N-(4-iodophenyl)-1,3-thiazole-5-carboxamide |
| SMILES | CCN(C)c1nc(N)c(C(=O)Nc2ccc(I)cc2)s1 |
| InChI | InChI=1S/C13H15IN4OS/c1-3-18(2)13-17-11(15)10(20-13)12(19)16-9-6-4-8(14)5-7-9/h4-7H,3,15H2,1-2H3,(H,16,19) |
| InChIKey | YLPZISJHZPRRRK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.26 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|