C20H19FN4O4S — CID 26919839
N'-[5-(4-fluorophenyl)furan-2-carbonyl]-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide (PubChem CID 26919839) has the molecular formula C20H19FN4O4S and a molecular weight of 430.46 g/mol. Its IUPAC name is N'-[5-(4-fluorophenyl)furan-2-carbonyl]-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide.
| Compound Name | N'-[5-(4-fluorophenyl)furan-2-carbonyl]-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 26919839 |
| Molecular Formula | C20H19FN4O4S |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | N'-[5-(4-fluorophenyl)furan-2-carbonyl]-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1nc(N2CCOCC2)sc1C(=O)NNC(=O)c1ccc(-c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C20H19FN4O4S/c1-12-17(30-20(22-12)25-8-10-28-11-9-25)19(27)24-23-18(26)16-7-6-15(29-16)13-2-4-14(21)5-3-13/h2-7H,8-11H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | XROLDAGRQSALRF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|