C22H18ClN3O3S2 — CID 2423405
(E)-2-(4-chlorophenyl)sulfonyl-3-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)prop-2-enenitrile (PubChem CID 2423405) has the molecular formula C22H18ClN3O3S2 and a molecular weight of 471.99 g/mol. Its IUPAC name is (E)-2-(4-chlorophenyl)sulfonyl-3-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)prop-2-enenitrile.
| Compound Name | (E)-2-(4-chlorophenyl)sulfonyl-3-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 2423405 |
| Molecular Formula | C22H18ClN3O3S2 |
| Molecular Weight | 471.99 g/mol |
| Exact Mass | 471.05 |
| IUPAC Name | (E)-2-(4-chlorophenyl)sulfonyl-3-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1sc(N2CCOCC2)nc1-c1ccccc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H18ClN3O3S2/c23-17-6-8-18(9-7-17)31(27,28)19(15-24)14-20-21(16-4-2-1-3-5-16)25-22(30-20)26-10-12-29-13-11-26/h1-9,14H,10-13H2/b19-14+ |
| InChIKey | CNXMBIASHBNJGM-XMHGGMMESA-N |
| XLogP | 4.64 |
| TPSA | 83.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.99 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|