C31H41NO4 — CID 150701691
3-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-1,4-dihydroxynaphthalene-2-carboxamide (PubChem CID 150701691) has the molecular formula C31H41NO4 and a molecular weight of 491.67 g/mol. Its IUPAC name is 3-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-1,4-dihydroxynaphthalene-2-carboxamide.
| Compound Name | 3-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-1,4-dihydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 150701691 |
| Molecular Formula | C31H41NO4 |
| Molecular Weight | 491.67 g/mol |
| Exact Mass | 491.30 |
| IUPAC Name | 3-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-1,4-dihydroxynaphthalene-2-carboxamide |
| SMILES | CCC(C)(C)c1ccc(OCCCCc2c(C(N)=O)c(O)c3ccccc3c2O)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C31H41NO4/c1-7-30(3,4)20-16-17-25(24(19-20)31(5,6)8-2)36-18-12-11-15-23-26(29(32)35)28(34)22-14-10-9-13-21(22)27(23)33/h9-10,13-14,16-17,19,33-34H,7-8,11-12,15,18H2,1-6H3,(H2,32,35) |
| InChIKey | JMAARDACHPXLOZ-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.67 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|