C38H46N4O3 — CID 91696288
N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-1-hydroxy-4-(5-methylbenzotriazol-2-yl)naphthalene-2-carboxamide (PubChem CID 91696288) has the molecular formula C38H46N4O3 and a molecular weight of 606.81 g/mol. Its IUPAC name is N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-1-hydroxy-4-(5-methylbenzotriazol-2-yl)naphthalene-2-carboxamide.
| Compound Name | N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-1-hydroxy-4-(5-methylbenzotriazol-2-yl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 91696288 |
| Molecular Formula | C38H46N4O3 |
| Molecular Weight | 606.81 g/mol |
| Exact Mass | 606.36 |
| IUPAC Name | N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-1-hydroxy-4-(5-methylbenzotriazol-2-yl)naphthalene-2-carboxamide |
| SMILES | CCC(C)(C)c1ccc(OCCCCNC(=O)c2cc(-n3nc4ccc(C)cc4n3)c3ccccc3c2O)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C38H46N4O3/c1-8-37(4,5)26-17-19-34(30(23-26)38(6,7)9-2)45-21-13-12-20-39-36(44)29-24-33(27-14-10-11-15-28(27)35(29)43)42-40-31-18-16-25(3)22-32(31)41-42/h10-11,14-19,22-24,43H,8-9,12-13,20-21H2,1-7H3,(H,39,44) |
| InChIKey | UGVISPBGTMGSIR-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.81 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|