C37H50N4O2 — CID 42659793
N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-2-methyl-3-phenyl-7-propylpyrazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 42659793) has the molecular formula C37H50N4O2 and a molecular weight of 582.83 g/mol. Its IUPAC name is N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-2-methyl-3-phenyl-7-propylpyrazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-2-methyl-3-phenyl-7-propylpyrazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 42659793 |
| Molecular Formula | C37H50N4O2 |
| Molecular Weight | 582.83 g/mol |
| Exact Mass | 582.39 |
| IUPAC Name | N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-2-methyl-3-phenyl-7-propylpyrazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCCc1c(C(=O)NCCCCOc2ccc(C(C)(C)CC)cc2C(C)(C)CC)cnc2c(-c3ccccc3)c(C)nn12 |
| InChI | InChI=1S/C37H50N4O2/c1-9-17-31-29(25-39-34-33(26(4)40-41(31)34)27-18-13-12-14-19-27)35(42)38-22-15-16-23-43-32-21-20-28(36(5,6)10-2)24-30(32)37(7,8)11-3/h12-14,18-21,24-25H,9-11,15-17,22-23H2,1-8H3,(H,38,42) |
| InChIKey | SCZIKXJRSXQPCP-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.83 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|