C36H44FN3O2 — CID 42660554
N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-3-(4-fluorophenyl)-1-phenylpyrazole-5-carboxamide (PubChem CID 42660554) has the molecular formula C36H44FN3O2 and a molecular weight of 569.77 g/mol. Its IUPAC name is N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-3-(4-fluorophenyl)-1-phenylpyrazole-5-carboxamide.
| Compound Name | N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-3-(4-fluorophenyl)-1-phenylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 42660554 |
| Molecular Formula | C36H44FN3O2 |
| Molecular Weight | 569.77 g/mol |
| Exact Mass | 569.34 |
| IUPAC Name | N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-3-(4-fluorophenyl)-1-phenylpyrazole-5-carboxamide |
| SMILES | CCC(C)(C)c1ccc(OCCCCNC(=O)c2cc(-c3ccc(F)cc3)nn2-c2ccccc2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C36H44FN3O2/c1-7-35(3,4)27-18-21-33(30(24-27)36(5,6)8-2)42-23-13-12-22-38-34(41)32-25-31(26-16-19-28(37)20-17-26)39-40(32)29-14-10-9-11-15-29/h9-11,14-21,24-25H,7-8,12-13,22-23H2,1-6H3,(H,38,41) |
| InChIKey | UPGLZTGEEXTYFZ-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.77 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|