C36H43ClN4O4 — CID 42761784
N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-1-(3-chlorophenyl)-3-(4-nitrophenyl)pyrazole-5-carboxamide (PubChem CID 42761784) has the molecular formula C36H43ClN4O4 and a molecular weight of 631.22 g/mol. Its IUPAC name is N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-1-(3-chlorophenyl)-3-(4-nitrophenyl)pyrazole-5-carboxamide.
| Compound Name | N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-1-(3-chlorophenyl)-3-(4-nitrophenyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 42761784 |
| Molecular Formula | C36H43ClN4O4 |
| Molecular Weight | 631.22 g/mol |
| Exact Mass | 630.30 |
| IUPAC Name | N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-1-(3-chlorophenyl)-3-(4-nitrophenyl)pyrazole-5-carboxamide |
| SMILES | CCC(C)(C)c1ccc(OCCCCNC(=O)c2cc(-c3ccc([N+](=O)[O-])cc3)nn2-c2cccc(Cl)c2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C36H43ClN4O4/c1-7-35(3,4)26-16-19-33(30(22-26)36(5,6)8-2)45-21-10-9-20-38-34(42)32-24-31(25-14-17-28(18-15-25)41(43)44)39-40(32)29-13-11-12-27(37)23-29/h11-19,22-24H,7-10,20-21H2,1-6H3,(H,38,42) |
| InChIKey | WGSBJHLNIXGLTH-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.22 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|