C34H43ClN2O4 — CID 42702324
N-benzyl-N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-2-chloro-4-nitrobenzamide (PubChem CID 42702324) has the molecular formula C34H43ClN2O4 and a molecular weight of 579.18 g/mol. Its IUPAC name is N-benzyl-N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-2-chloro-4-nitrobenzamide.
| Compound Name | N-benzyl-N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-2-chloro-4-nitrobenzamide |
|---|---|
| PubChem CID | 42702324 |
| Molecular Formula | C34H43ClN2O4 |
| Molecular Weight | 579.18 g/mol |
| Exact Mass | 578.29 |
| IUPAC Name | N-benzyl-N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-2-chloro-4-nitrobenzamide |
| SMILES | CCC(C)(C)c1ccc(OCCCCN(Cc2ccccc2)C(=O)c2ccc([N+](=O)[O-])cc2Cl)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C34H43ClN2O4/c1-7-33(3,4)26-16-19-31(29(22-26)34(5,6)8-2)41-21-13-12-20-36(24-25-14-10-9-11-15-25)32(38)28-18-17-27(37(39)40)23-30(28)35/h9-11,14-19,22-23H,7-8,12-13,20-21,24H2,1-6H3 |
| InChIKey | UXHFUOWJQCILNM-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.18 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|