C35H44FNO4 — CID 42697114
N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-N-[(2-fluorophenyl)methyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 42697114) has the molecular formula C35H44FNO4 and a molecular weight of 561.74 g/mol. Its IUPAC name is N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-N-[(2-fluorophenyl)methyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-N-[(2-fluorophenyl)methyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 42697114 |
| Molecular Formula | C35H44FNO4 |
| Molecular Weight | 561.74 g/mol |
| Exact Mass | 561.33 |
| IUPAC Name | N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-N-[(2-fluorophenyl)methyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | CCC(C)(C)c1ccc(OCCCCN(Cc2ccccc2F)C(=O)c2ccc3c(c2)OCO3)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C35H44FNO4/c1-7-34(3,4)27-16-18-30(28(22-27)35(5,6)8-2)39-20-12-11-19-37(23-26-13-9-10-14-29(26)36)33(38)25-15-17-31-32(21-25)41-24-40-31/h9-10,13-18,21-22H,7-8,11-12,19-20,23-24H2,1-6H3 |
| InChIKey | RDIHKNFYRWWQLG-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.74 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|