C35H48ClNO2 — CID 42725519
N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-4-chlorobenzamide (PubChem CID 42725519) has the molecular formula C35H48ClNO2 and a molecular weight of 550.23 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-4-chlorobenzamide.
| Compound Name | N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 42725519 |
| Molecular Formula | C35H48ClNO2 |
| Molecular Weight | 550.23 g/mol |
| Exact Mass | 549.34 |
| IUPAC Name | N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-4-chlorobenzamide |
| SMILES | CCC(C)(C)c1ccc(OCCCCN(CC2CC3C=CC2C3)C(=O)c2ccc(Cl)cc2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C35H48ClNO2/c1-7-34(3,4)29-15-18-32(31(23-29)35(5,6)8-2)39-20-10-9-19-37(24-28-22-25-11-12-27(28)21-25)33(38)26-13-16-30(36)17-14-26/h11-18,23,25,27-28H,7-10,19-22,24H2,1-6H3 |
| InChIKey | GOZWVERAQMHFGN-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.23 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|