C33H45FN2O2S — CID 42703028
1-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-3-(2-fluorophenyl)-1-[(3-methylthiophen-2-yl)methyl]urea (PubChem CID 42703028) has the molecular formula C33H45FN2O2S and a molecular weight of 552.80 g/mol. Its IUPAC name is 1-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-3-(2-fluorophenyl)-1-[(3-methylthiophen-2-yl)methyl]urea.
| Compound Name | 1-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-3-(2-fluorophenyl)-1-[(3-methylthiophen-2-yl)methyl]urea |
|---|---|
| PubChem CID | 42703028 |
| Molecular Formula | C33H45FN2O2S |
| Molecular Weight | 552.80 g/mol |
| Exact Mass | 552.32 |
| IUPAC Name | 1-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-3-(2-fluorophenyl)-1-[(3-methylthiophen-2-yl)methyl]urea |
| SMILES | CCC(C)(C)c1ccc(OCCCCN(Cc2sccc2C)C(=O)Nc2ccccc2F)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C33H45FN2O2S/c1-8-32(4,5)25-16-17-29(26(22-25)33(6,7)9-2)38-20-13-12-19-36(23-30-24(3)18-21-39-30)31(37)35-28-15-11-10-14-27(28)34/h10-11,14-18,21-22H,8-9,12-13,19-20,23H2,1-7H3,(H,35,37) |
| InChIKey | AABFYCFFLPCWST-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.80 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|