C37H50N2O3 — CID 4596998
1-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-1-[3-(2-methoxyphenyl)prop-2-enyl]-3-phenylurea (PubChem CID 4596998) has the molecular formula C37H50N2O3 and a molecular weight of 570.82 g/mol. Its IUPAC name is 1-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-1-[3-(2-methoxyphenyl)prop-2-enyl]-3-phenylurea.
| Compound Name | 1-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-1-[3-(2-methoxyphenyl)prop-2-enyl]-3-phenylurea |
|---|---|
| PubChem CID | 4596998 |
| Molecular Formula | C37H50N2O3 |
| Molecular Weight | 570.82 g/mol |
| Exact Mass | 570.38 |
| IUPAC Name | 1-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-1-[3-(2-methoxyphenyl)prop-2-enyl]-3-phenylurea |
| SMILES | CCC(C)(C)c1ccc(OCCCCN(CC=Cc2ccccc2OC)C(=O)Nc2ccccc2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C37H50N2O3/c1-8-36(3,4)30-23-24-34(32(28-30)37(5,6)9-2)42-27-16-15-25-39(35(40)38-31-20-11-10-12-21-31)26-17-19-29-18-13-14-22-33(29)41-7/h10-14,17-24,28H,8-9,15-16,25-27H2,1-7H3,(H,38,40) |
| InChIKey | NEHAXBNOTVNMMZ-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.82 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|