C22H22ClNO — CID 42701072
N-benzyl-N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-4-chlorobenzamide (PubChem CID 42701072) has the molecular formula C22H22ClNO and a molecular weight of 351.88 g/mol. Its IUPAC name is N-benzyl-N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-4-chlorobenzamide.
| Compound Name | N-benzyl-N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-4-chlorobenzamide |
|---|---|
| PubChem CID | 42701072 |
| Molecular Formula | C22H22ClNO |
| Molecular Weight | 351.88 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | N-benzyl-N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-4-chlorobenzamide |
| SMILES | O=C(c1ccc(Cl)cc1)N(Cc1ccccc1)CC1CC2C=CC1C2 |
| InChI | InChI=1S/C22H22ClNO/c23-21-10-8-18(9-11-21)22(25)24(14-16-4-2-1-3-5-16)15-20-13-17-6-7-19(20)12-17/h1-11,17,19-20H,12-15H2 |
| InChIKey | FZKFBCZCRPVEJN-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.88 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|