C19H23Cl2NO — CID 42700984
N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-2,4-dichloro-N-(2-methylpropyl)benzamide (PubChem CID 42700984) has the molecular formula C19H23Cl2NO and a molecular weight of 352.31 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-2,4-dichloro-N-(2-methylpropyl)benzamide.
| Compound Name | N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-2,4-dichloro-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 42700984 |
| Molecular Formula | C19H23Cl2NO |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-2,4-dichloro-N-(2-methylpropyl)benzamide |
| SMILES | CC(C)CN(CC1CC2C=CC1C2)C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H23Cl2NO/c1-12(2)10-22(11-15-8-13-3-4-14(15)7-13)19(23)17-6-5-16(20)9-18(17)21/h3-6,9,12-15H,7-8,10-11H2,1-2H3 |
| InChIKey | GRIRGDDVQYBJRU-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|