C20H25Cl2NO — CID 42724667
N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-2,4-dichloro-N-(3-methylbutan-2-yl)benzamide (PubChem CID 42724667) has the molecular formula C20H25Cl2NO and a molecular weight of 366.33 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-2,4-dichloro-N-(3-methylbutan-2-yl)benzamide.
| Compound Name | N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-2,4-dichloro-N-(3-methylbutan-2-yl)benzamide |
|---|---|
| PubChem CID | 42724667 |
| Molecular Formula | C20H25Cl2NO |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-2,4-dichloro-N-(3-methylbutan-2-yl)benzamide |
| SMILES | CC(C)C(C)N(CC1CC2C=CC1C2)C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H25Cl2NO/c1-12(2)13(3)23(11-16-9-14-4-5-15(16)8-14)20(24)18-7-6-17(21)10-19(18)22/h4-7,10,12-16H,8-9,11H2,1-3H3 |
| InChIKey | HKBWRAJROIYOMK-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|