C19H20ClNO3S — CID 102566153
N-benzyl-4-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]benzamide (PubChem CID 102566153) has the molecular formula C19H20ClNO3S and a molecular weight of 377.89 g/mol. Its IUPAC name is N-benzyl-4-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]benzamide.
| Compound Name | N-benzyl-4-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 102566153 |
| Molecular Formula | C19H20ClNO3S |
| Molecular Weight | 377.89 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | N-benzyl-4-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]benzamide |
| SMILES | O=C(c1ccc(Cl)cc1)N(Cc1ccccc1)CC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H20ClNO3S/c20-18-8-6-17(7-9-18)19(22)21(12-15-4-2-1-3-5-15)13-16-10-11-25(23,24)14-16/h1-9,16H,10-14H2 |
| InChIKey | XVNRUZDLUXSWHE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.89 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |