C15H21NO4S — CID 99976023
ethyl N-benzyl-N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]carbamate (PubChem CID 99976023) has the molecular formula C15H21NO4S and a molecular weight of 311.40 g/mol. Its IUPAC name is ethyl N-benzyl-N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]carbamate.
| Compound Name | ethyl N-benzyl-N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 99976023 |
| Molecular Formula | C15H21NO4S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | ethyl N-benzyl-N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]carbamate |
| SMILES | CCOC(=O)N(Cc1ccccc1)C[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H21NO4S/c1-2-20-15(17)16(10-13-6-4-3-5-7-13)11-14-8-9-21(18,19)12-14/h3-7,14H,2,8-12H2,1H3/t14-/m0/s1 |
| InChIKey | WXLYULLGABMCJA-AWEZNQCLSA-N |
| XLogP | 2.08 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |