ethyl N-benzyl-N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]carbamate

C15H21NO4S — CID 99976023

IUPACethyl N-benzyl-N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]carbamate
SMILESCCOC(=O)N(Cc1ccccc1)C[C@@H]1CCS(=O)(=O)C1
InChIInChI=1S/C15H21NO4S/c1-2-20-15(17)16(10-13-6-4-3-5-7-13)11-14-8-9-21(18,19)12-14/h3-7,14H,2,8-12H2,1H3/t14-/m0/s1
InChIKeyWXLYULLGABMCJA-AWEZNQCLSA-N
MW311.40 g/mol
LogP2.08
Rot. Bonds5

About ethyl N-benzyl-N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]carbamate

ethyl N-benzyl-N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]carbamate (PubChem CID 99976023) has the molecular formula C15H21NO4S and a molecular weight of 311.40 g/mol. Its IUPAC name is ethyl N-benzyl-N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]carbamate.

Molecular Properties

Compound Nameethyl N-benzyl-N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]carbamate
PubChem CID99976023
Molecular FormulaC15H21NO4S
Molecular Weight311.40 g/mol
Exact Mass311.12
IUPAC Nameethyl N-benzyl-N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]carbamate
SMILESCCOC(=O)N(Cc1ccccc1)C[C@@H]1CCS(=O)(=O)C1
InChIInChI=1S/C15H21NO4S/c1-2-20-15(17)16(10-13-6-4-3-5-7-13)11-14-8-9-21(18,19)12-14/h3-7,14H,2,8-12H2,1H3/t14-/m0/s1
InChIKeyWXLYULLGABMCJA-AWEZNQCLSA-N
XLogP2.08
TPSA63.68 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500311.40
LogP ≤ 52.08
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze ethyl N-benzyl-N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]carbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl N-benzyl-N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]carbamate?
The IUPAC name of ethyl N-benzyl-N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]carbamate (CID 99976023) is ethyl N-benzyl-N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]carbamate.
What is the SMILES notation for ethyl N-benzyl-N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]carbamate?
The canonical SMILES for ethyl N-benzyl-N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]carbamate is CCOC(=O)N(Cc1ccccc1)C[C@@H]1CCS(=O)(=O)C1.
What is the InChIKey of ethyl N-benzyl-N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]carbamate?
The InChIKey is WXLYULLGABMCJA-AWEZNQCLSA-N. The full InChI is InChI=1S/C15H21NO4S/c1-2-20-15(17)16(10-13-6-4-3-5-7-13)11-14-8-9-21(18,19)12-14/h3-7,14H,2,8-12H2,1H3/t14-/m0/s1.
What are the key properties of ethyl N-benzyl-N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]carbamate?
ethyl N-benzyl-N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]carbamate has a molecular weight of 311.40 g/mol, XLogP of 2.08, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-benzyl-N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]carbamate is sourced from PubChem (CID 99976023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).