C26H22ClN3O5 — CID 30343232
N-benzyl-2-chloro-4-nitro-N-[3-[(2-oxochromen-4-yl)amino]propyl]benzamide (PubChem CID 30343232) has the molecular formula C26H22ClN3O5 and a molecular weight of 491.93 g/mol. Its IUPAC name is N-benzyl-2-chloro-4-nitro-N-[3-[(2-oxochromen-4-yl)amino]propyl]benzamide.
| Compound Name | N-benzyl-2-chloro-4-nitro-N-[3-[(2-oxochromen-4-yl)amino]propyl]benzamide |
|---|---|
| PubChem CID | 30343232 |
| Molecular Formula | C26H22ClN3O5 |
| Molecular Weight | 491.93 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | N-benzyl-2-chloro-4-nitro-N-[3-[(2-oxochromen-4-yl)amino]propyl]benzamide |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1Cl)N(CCCNc1cc(=O)oc2ccccc12)Cc1ccccc1 |
| InChI | InChI=1S/C26H22ClN3O5/c27-22-15-19(30(33)34)11-12-20(22)26(32)29(17-18-7-2-1-3-8-18)14-6-13-28-23-16-25(31)35-24-10-5-4-9-21(23)24/h1-5,7-12,15-16,28H,6,13-14,17H2 |
| InChIKey | VQGQVFYUWYWQQI-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 105.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.93 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|