C27H25FN2O4 — CID 30343292
N-benzyl-2-(4-fluorophenoxy)-N-[3-[(2-oxochromen-4-yl)amino]propyl]acetamide (PubChem CID 30343292) has the molecular formula C27H25FN2O4 and a molecular weight of 460.51 g/mol. Its IUPAC name is N-benzyl-2-(4-fluorophenoxy)-N-[3-[(2-oxochromen-4-yl)amino]propyl]acetamide.
| Compound Name | N-benzyl-2-(4-fluorophenoxy)-N-[3-[(2-oxochromen-4-yl)amino]propyl]acetamide |
|---|---|
| PubChem CID | 30343292 |
| Molecular Formula | C27H25FN2O4 |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | N-benzyl-2-(4-fluorophenoxy)-N-[3-[(2-oxochromen-4-yl)amino]propyl]acetamide |
| SMILES | O=C(COc1ccc(F)cc1)N(CCCNc1cc(=O)oc2ccccc12)Cc1ccccc1 |
| InChI | InChI=1S/C27H25FN2O4/c28-21-11-13-22(14-12-21)33-19-26(31)30(18-20-7-2-1-3-8-20)16-6-15-29-24-17-27(32)34-25-10-5-4-9-23(24)25/h1-5,7-14,17,29H,6,15-16,18-19H2 |
| InChIKey | FTRFIGBRUJHWQW-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|