C25H30N2O3 — CID 30343425
N-benzyl-N-[3-[(2-oxochromen-4-yl)amino]propyl]hexanamide (PubChem CID 30343425) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is N-benzyl-N-[3-[(2-oxochromen-4-yl)amino]propyl]hexanamide.
| Compound Name | N-benzyl-N-[3-[(2-oxochromen-4-yl)amino]propyl]hexanamide |
|---|---|
| PubChem CID | 30343425 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | N-benzyl-N-[3-[(2-oxochromen-4-yl)amino]propyl]hexanamide |
| SMILES | CCCCCC(=O)N(CCCNc1cc(=O)oc2ccccc12)Cc1ccccc1 |
| InChI | InChI=1S/C25H30N2O3/c1-2-3-5-15-24(28)27(19-20-11-6-4-7-12-20)17-10-16-26-22-18-25(29)30-23-14-9-8-13-21(22)23/h4,6-9,11-14,18,26H,2-3,5,10,15-17,19H2,1H3 |
| InChIKey | HNXVFMCXZJGKBX-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|