C38H48ClN3O2 — CID 3685469
N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-3-(2-chlorophenyl)-1-(2,4-dimethylphenyl)pyrazole-5-carboxamide (PubChem CID 3685469) has the molecular formula C38H48ClN3O2 and a molecular weight of 614.27 g/mol. Its IUPAC name is N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-3-(2-chlorophenyl)-1-(2,4-dimethylphenyl)pyrazole-5-carboxamide.
| Compound Name | N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-3-(2-chlorophenyl)-1-(2,4-dimethylphenyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 3685469 |
| Molecular Formula | C38H48ClN3O2 |
| Molecular Weight | 614.27 g/mol |
| Exact Mass | 613.34 |
| IUPAC Name | N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-3-(2-chlorophenyl)-1-(2,4-dimethylphenyl)pyrazole-5-carboxamide |
| SMILES | CCC(C)(C)c1ccc(OCCCCNC(=O)c2cc(-c3ccccc3Cl)nn2-c2ccc(C)cc2C)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C38H48ClN3O2/c1-9-37(5,6)28-18-20-35(30(24-28)38(7,8)10-2)44-22-14-13-21-40-36(43)34-25-32(29-15-11-12-16-31(29)39)41-42(34)33-19-17-26(3)23-27(33)4/h11-12,15-20,23-25H,9-10,13-14,21-22H2,1-8H3,(H,40,43) |
| InChIKey | VVWGIVZSMYVCGO-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.27 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|