C41H53N3O3 — CID 20680169
N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-4-[4-[ethyl(methyl)amino]-2-methylphenyl]imino-1-oxonaphthalene-2-carboxamide (PubChem CID 20680169) has the molecular formula C41H53N3O3 and a molecular weight of 635.89 g/mol. Its IUPAC name is N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-4-[4-[ethyl(methyl)amino]-2-methylphenyl]imino-1-oxonaphthalene-2-carboxamide.
| Compound Name | N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-4-[4-[ethyl(methyl)amino]-2-methylphenyl]imino-1-oxonaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 20680169 |
| Molecular Formula | C41H53N3O3 |
| Molecular Weight | 635.89 g/mol |
| Exact Mass | 635.41 |
| IUPAC Name | N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-4-[4-[ethyl(methyl)amino]-2-methylphenyl]imino-1-oxonaphthalene-2-carboxamide |
| SMILES | CCN(C)c1ccc(/N=C2\C=C(C(=O)NCCCCOc3ccc(C(C)(C)CC)cc3C(C)(C)CC)C(=O)c3ccccc32)c(C)c1 |
| InChI | InChI=1S/C41H53N3O3/c1-10-40(5,6)29-19-22-37(34(26-29)41(7,8)11-2)47-24-16-15-23-42-39(46)33-27-36(31-17-13-14-18-32(31)38(33)45)43-35-21-20-30(25-28(35)4)44(9)12-3/h13-14,17-22,25-27H,10-12,15-16,23-24H2,1-9H3,(H,42,46)/b43-36+ |
| InChIKey | DSKPZXPEULRHAZ-MJUMFWDOSA-N |
| XLogP | 9.05 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.89 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|