C36H50N2O5 — CID 14028667
N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-1-hydroxy-4-[2-oxo-2-(propan-2-ylamino)ethoxy]naphthalene-2-carboxamide (PubChem CID 14028667) has the molecular formula C36H50N2O5 and a molecular weight of 590.81 g/mol. Its IUPAC name is N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-1-hydroxy-4-[2-oxo-2-(propan-2-ylamino)ethoxy]naphthalene-2-carboxamide.
| Compound Name | N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-1-hydroxy-4-[2-oxo-2-(propan-2-ylamino)ethoxy]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 14028667 |
| Molecular Formula | C36H50N2O5 |
| Molecular Weight | 590.81 g/mol |
| Exact Mass | 590.37 |
| IUPAC Name | N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-1-hydroxy-4-[2-oxo-2-(propan-2-ylamino)ethoxy]naphthalene-2-carboxamide |
| SMILES | CCC(C)(C)c1ccc(OCCCCNC(=O)c2cc(OCC(=O)NC(C)C)c3ccccc3c2O)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C36H50N2O5/c1-9-35(5,6)25-17-18-30(29(21-25)36(7,8)10-2)42-20-14-13-19-37-34(41)28-22-31(43-23-32(39)38-24(3)4)26-15-11-12-16-27(26)33(28)40/h11-12,15-18,21-22,24,40H,9-10,13-14,19-20,23H2,1-8H3,(H,37,41)(H,38,39) |
| InChIKey | QAZVALXFVCOJLJ-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.81 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|