C20H21ClFN4O+ — CID 7231781
2-[[1-(3-chlorophenyl)-3-(4-fluorophenyl)pyrazole-5-carbonyl]amino]ethyl-dimethylazanium (PubChem CID 7231781) has the molecular formula C20H21ClFN4O+ and a molecular weight of 387.87 g/mol. Its IUPAC name is 2-[[1-(3-chlorophenyl)-3-(4-fluorophenyl)pyrazole-5-carbonyl]amino]ethyl-dimethylazanium.
| Compound Name | 2-[[1-(3-chlorophenyl)-3-(4-fluorophenyl)pyrazole-5-carbonyl]amino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 7231781 |
| Molecular Formula | C20H21ClFN4O+ |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 2-[[1-(3-chlorophenyl)-3-(4-fluorophenyl)pyrazole-5-carbonyl]amino]ethyl-dimethylazanium |
| SMILES | C[NH+](C)CCNC(=O)c1cc(-c2ccc(F)cc2)nn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H20ClFN4O/c1-25(2)11-10-23-20(27)19-13-18(14-6-8-16(22)9-7-14)24-26(19)17-5-3-4-15(21)12-17/h3-9,12-13H,10-11H2,1-2H3,(H,23,27)/p+1 |
| InChIKey | GGLDZOGSPUBBBC-UHFFFAOYSA-O |
| XLogP | 2.21 |
| TPSA | 51.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |