C20H15ClFN3O — CID 90548545
N-[3-(3-chlorophenyl)prop-2-ynyl]-3-(4-fluorophenyl)-1-methylpyrazole-5-carboxamide (PubChem CID 90548545) has the molecular formula C20H15ClFN3O and a molecular weight of 367.81 g/mol. Its IUPAC name is N-[3-(3-chlorophenyl)prop-2-ynyl]-3-(4-fluorophenyl)-1-methylpyrazole-5-carboxamide.
| Compound Name | N-[3-(3-chlorophenyl)prop-2-ynyl]-3-(4-fluorophenyl)-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 90548545 |
| Molecular Formula | C20H15ClFN3O |
| Molecular Weight | 367.81 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | N-[3-(3-chlorophenyl)prop-2-ynyl]-3-(4-fluorophenyl)-1-methylpyrazole-5-carboxamide |
| SMILES | Cn1nc(-c2ccc(F)cc2)cc1C(=O)NCC#Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C20H15ClFN3O/c1-25-19(13-18(24-25)15-7-9-17(22)10-8-15)20(26)23-11-3-5-14-4-2-6-16(21)12-14/h2,4,6-10,12-13H,11H2,1H3,(H,23,26) |
| InChIKey | DZAZJSZSQJPCRF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.81 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|